C14H23N3O2S2 — CID 124989530
2-[(3S)-1-(1-methylsulfonylpiperidin-4-yl)piperidin-3-yl]-1,3-thiazole (PubChem CID 124989530) has the molecular formula C14H23N3O2S2 and a molecular weight of 329.49 g/mol. Its IUPAC name is 2-[(3S)-1-(1-methylsulfonylpiperidin-4-yl)piperidin-3-yl]-1,3-thiazole.
| Compound Name | 2-[(3S)-1-(1-methylsulfonylpiperidin-4-yl)piperidin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 124989530 |
| Molecular Formula | C14H23N3O2S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-[(3S)-1-(1-methylsulfonylpiperidin-4-yl)piperidin-3-yl]-1,3-thiazole |
| SMILES | CS(=O)(=O)N1CCC(N2CCC[C@H](c3nccs3)C2)CC1 |
| InChI | InChI=1S/C14H23N3O2S2/c1-21(18,19)17-8-4-13(5-9-17)16-7-2-3-12(11-16)14-15-6-10-20-14/h6,10,12-13H,2-5,7-9,11H2,1H3/t12-/m0/s1 |
| InChIKey | OUYOIBHAOYYCQE-LBPRGKRZSA-N |
| XLogP | 1.75 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |