C18H29N3O2S — CID 124951672
2-methyl-5-[[(3S)-1-(1-methylsulfonylpiperidin-4-yl)piperidin-3-yl]methyl]pyridine (PubChem CID 124951672) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is 2-methyl-5-[[(3S)-1-(1-methylsulfonylpiperidin-4-yl)piperidin-3-yl]methyl]pyridine.
| Compound Name | 2-methyl-5-[[(3S)-1-(1-methylsulfonylpiperidin-4-yl)piperidin-3-yl]methyl]pyridine |
|---|---|
| PubChem CID | 124951672 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2-methyl-5-[[(3S)-1-(1-methylsulfonylpiperidin-4-yl)piperidin-3-yl]methyl]pyridine |
| SMILES | Cc1ccc(C[C@@H]2CCCN(C3CCN(S(C)(=O)=O)CC3)C2)cn1 |
| InChI | InChI=1S/C18H29N3O2S/c1-15-5-6-16(13-19-15)12-17-4-3-9-20(14-17)18-7-10-21(11-8-18)24(2,22)23/h5-6,13,17-18H,3-4,7-12,14H2,1-2H3/t17-/m0/s1 |
| InChIKey | DJHCQEKPPJACTC-KRWDZBQOSA-N |
| XLogP | 2.07 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |