C16H22N4O2S — CID 110102093
2-(5-methyl-1H-pyrazol-3-yl)-5-[(1-methylsulfonylpiperidin-4-yl)methyl]pyridine (PubChem CID 110102093) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 2-(5-methyl-1H-pyrazol-3-yl)-5-[(1-methylsulfonylpiperidin-4-yl)methyl]pyridine.
| Compound Name | 2-(5-methyl-1H-pyrazol-3-yl)-5-[(1-methylsulfonylpiperidin-4-yl)methyl]pyridine |
|---|---|
| PubChem CID | 110102093 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-(5-methyl-1H-pyrazol-3-yl)-5-[(1-methylsulfonylpiperidin-4-yl)methyl]pyridine |
| SMILES | Cc1cc(-c2ccc(CC3CCN(S(C)(=O)=O)CC3)cn2)n[nH]1 |
| InChI | InChI=1S/C16H22N4O2S/c1-12-9-16(19-18-12)15-4-3-14(11-17-15)10-13-5-7-20(8-6-13)23(2,21)22/h3-4,9,11,13H,5-8,10H2,1-2H3,(H,18,19) |
| InChIKey | OVFPYEOKJBJAKU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |