C18H20N2O4S — CID 124939693
4-[5-[[(3S)-1-methylsulfonylpyrrolidin-3-yl]methyl]-2-pyridinyl]benzoic acid (PubChem CID 124939693) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 4-[5-[[(3S)-1-methylsulfonylpyrrolidin-3-yl]methyl]-2-pyridinyl]benzoic acid.
| Compound Name | 4-[5-[[(3S)-1-methylsulfonylpyrrolidin-3-yl]methyl]-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 124939693 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-[5-[[(3S)-1-methylsulfonylpyrrolidin-3-yl]methyl]-2-pyridinyl]benzoic acid |
| SMILES | CS(=O)(=O)N1CC[C@H](Cc2ccc(-c3ccc(C(=O)O)cc3)nc2)C1 |
| InChI | InChI=1S/C18H20N2O4S/c1-25(23,24)20-9-8-14(12-20)10-13-2-7-17(19-11-13)15-3-5-16(6-4-15)18(21)22/h2-7,11,14H,8-10,12H2,1H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | ABFDOSFAQUJTDK-CQSZACIVSA-N |
| XLogP | 2.27 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |