C18H21N3O4S — CID 110112210
4-[3-[(1-methylsulfonylpiperidin-3-yl)methyl]pyrazin-2-yl]benzoic acid (PubChem CID 110112210) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-[3-[(1-methylsulfonylpiperidin-3-yl)methyl]pyrazin-2-yl]benzoic acid.
| Compound Name | 4-[3-[(1-methylsulfonylpiperidin-3-yl)methyl]pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 110112210 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-[3-[(1-methylsulfonylpiperidin-3-yl)methyl]pyrazin-2-yl]benzoic acid |
| SMILES | CS(=O)(=O)N1CCCC(Cc2nccnc2-c2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C18H21N3O4S/c1-26(24,25)21-10-2-3-13(12-21)11-16-17(20-9-8-19-16)14-4-6-15(7-5-14)18(22)23/h4-9,13H,2-3,10-12H2,1H3,(H,22,23) |
| InChIKey | OIZMSAYWHMTGBN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |