C20H25N3O4S — CID 125019948
4-[3-[[(3R)-1-(dimethylsulfamoyl)piperidin-3-yl]methyl]-2-pyridinyl]benzoic acid (PubChem CID 125019948) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is 4-[3-[[(3R)-1-(dimethylsulfamoyl)piperidin-3-yl]methyl]-2-pyridinyl]benzoic acid.
| Compound Name | 4-[3-[[(3R)-1-(dimethylsulfamoyl)piperidin-3-yl]methyl]-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 125019948 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-[3-[[(3R)-1-(dimethylsulfamoyl)piperidin-3-yl]methyl]-2-pyridinyl]benzoic acid |
| SMILES | CN(C)S(=O)(=O)N1CCC[C@H](Cc2cccnc2-c2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C20H25N3O4S/c1-22(2)28(26,27)23-12-4-5-15(14-23)13-18-6-3-11-21-19(18)16-7-9-17(10-8-16)20(24)25/h3,6-11,15H,4-5,12-14H2,1-2H3,(H,24,25)/t15-/m1/s1 |
| InChIKey | XZNCKHAXXJFKIQ-OAHLLOKOSA-N |
| XLogP | 2.51 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |