C14H19N5O2S — CID 124968603
2-(1-methylimidazol-2-yl)-3-[[(3R)-1-methylsulfonylpyrrolidin-3-yl]methyl]pyrazine (PubChem CID 124968603) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)-3-[[(3R)-1-methylsulfonylpyrrolidin-3-yl]methyl]pyrazine.
| Compound Name | 2-(1-methylimidazol-2-yl)-3-[[(3R)-1-methylsulfonylpyrrolidin-3-yl]methyl]pyrazine |
|---|---|
| PubChem CID | 124968603 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)-3-[[(3R)-1-methylsulfonylpyrrolidin-3-yl]methyl]pyrazine |
| SMILES | Cn1ccnc1-c1nccnc1C[C@H]1CCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H19N5O2S/c1-18-8-6-17-14(18)13-12(15-4-5-16-13)9-11-3-7-19(10-11)22(2,20)21/h4-6,8,11H,3,7,9-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | JCHZQMKKIQBNJK-LLVKDONJSA-N |
| XLogP | 0.70 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |