C19H23N7 — CID 125021370
2-(1-methylimidazol-2-yl)-3-[[(3S)-1-(pyrazin-2-ylmethyl)piperidin-3-yl]methyl]pyrazine (PubChem CID 125021370) has the molecular formula C19H23N7 and a molecular weight of 349.44 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)-3-[[(3S)-1-(pyrazin-2-ylmethyl)piperidin-3-yl]methyl]pyrazine.
| Compound Name | 2-(1-methylimidazol-2-yl)-3-[[(3S)-1-(pyrazin-2-ylmethyl)piperidin-3-yl]methyl]pyrazine |
|---|---|
| PubChem CID | 125021370 |
| Molecular Formula | C19H23N7 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)-3-[[(3S)-1-(pyrazin-2-ylmethyl)piperidin-3-yl]methyl]pyrazine |
| SMILES | Cn1ccnc1-c1nccnc1C[C@@H]1CCCN(Cc2cnccn2)C1 |
| InChI | InChI=1S/C19H23N7/c1-25-10-8-24-19(25)18-17(22-6-7-23-18)11-15-3-2-9-26(13-15)14-16-12-20-4-5-21-16/h4-8,10,12,15H,2-3,9,11,13-14H2,1H3/t15-/m0/s1 |
| InChIKey | YJEXNYNWFZRIKL-HNNXBMFYSA-N |
| XLogP | 2.12 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |