C15H21N5O2S — CID 125017567
2-[[(3R)-3-[(4-methylsulfonyl-1H-pyrazol-5-yl)methyl]piperidin-1-yl]methyl]pyrazine (PubChem CID 125017567) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-[[(3R)-3-[(4-methylsulfonyl-1H-pyrazol-5-yl)methyl]piperidin-1-yl]methyl]pyrazine.
| Compound Name | 2-[[(3R)-3-[(4-methylsulfonyl-1H-pyrazol-5-yl)methyl]piperidin-1-yl]methyl]pyrazine |
|---|---|
| PubChem CID | 125017567 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-[[(3R)-3-[(4-methylsulfonyl-1H-pyrazol-5-yl)methyl]piperidin-1-yl]methyl]pyrazine |
| SMILES | CS(=O)(=O)c1cn[nH]c1C[C@H]1CCCN(Cc2cnccn2)C1 |
| InChI | InChI=1S/C15H21N5O2S/c1-23(21,22)15-9-18-19-14(15)7-12-3-2-6-20(10-12)11-13-8-16-4-5-17-13/h4-5,8-9,12H,2-3,6-7,10-11H2,1H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | XIGKQBYDKMCURV-GFCCVEGCSA-N |
| XLogP | 1.06 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |