C17H22FN3O2S — CID 124945183
(3R)-1-[(4-fluorophenyl)methyl]-3-[(4-methylsulfonyl-1H-pyrazol-5-yl)methyl]piperidine (PubChem CID 124945183) has the molecular formula C17H22FN3O2S and a molecular weight of 351.45 g/mol. Its IUPAC name is (3R)-1-[(4-fluorophenyl)methyl]-3-[(4-methylsulfonyl-1H-pyrazol-5-yl)methyl]piperidine.
| Compound Name | (3R)-1-[(4-fluorophenyl)methyl]-3-[(4-methylsulfonyl-1H-pyrazol-5-yl)methyl]piperidine |
|---|---|
| PubChem CID | 124945183 |
| Molecular Formula | C17H22FN3O2S |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (3R)-1-[(4-fluorophenyl)methyl]-3-[(4-methylsulfonyl-1H-pyrazol-5-yl)methyl]piperidine |
| SMILES | CS(=O)(=O)c1cn[nH]c1C[C@H]1CCCN(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H22FN3O2S/c1-24(22,23)17-10-19-20-16(17)9-14-3-2-8-21(12-14)11-13-4-6-15(18)7-5-13/h4-7,10,14H,2-3,8-9,11-12H2,1H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | BPDISRMMOYPNLJ-CQSZACIVSA-N |
| XLogP | 2.41 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |