C16H22N4O2S — CID 124973199
2-[[(3S)-3-[(4-methylsulfonyl-1H-pyrazol-5-yl)methyl]piperidin-1-yl]methyl]pyridine (PubChem CID 124973199) has the molecular formula C16H22N4O2S and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-[[(3S)-3-[(4-methylsulfonyl-1H-pyrazol-5-yl)methyl]piperidin-1-yl]methyl]pyridine.
| Compound Name | 2-[[(3S)-3-[(4-methylsulfonyl-1H-pyrazol-5-yl)methyl]piperidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 124973199 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-[[(3S)-3-[(4-methylsulfonyl-1H-pyrazol-5-yl)methyl]piperidin-1-yl]methyl]pyridine |
| SMILES | CS(=O)(=O)c1cn[nH]c1C[C@@H]1CCCN(Cc2ccccn2)C1 |
| InChI | InChI=1S/C16H22N4O2S/c1-23(21,22)16-10-18-19-15(16)9-13-5-4-8-20(11-13)12-14-6-2-3-7-17-14/h2-3,6-7,10,13H,4-5,8-9,11-12H2,1H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | KINIOUPJDMCEBA-ZDUSSCGKSA-N |
| XLogP | 1.66 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |