C19H19BrCl2N2O2 — CID 19208201
4-(2-bromo-4-ethylphenoxy)-N-[(E)-(3,4-dichlorophenyl)methylideneamino]butanamide (PubChem CID 19208201) has the molecular formula C19H19BrCl2N2O2 and a molecular weight of 458.18 g/mol. Its IUPAC name is 4-(2-bromo-4-ethylphenoxy)-N-[(E)-(3,4-dichlorophenyl)methylideneamino]butanamide.
| Compound Name | 4-(2-bromo-4-ethylphenoxy)-N-[(E)-(3,4-dichlorophenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 19208201 |
| Molecular Formula | C19H19BrCl2N2O2 |
| Molecular Weight | 458.18 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | 4-(2-bromo-4-ethylphenoxy)-N-[(E)-(3,4-dichlorophenyl)methylideneamino]butanamide |
| SMILES | CCc1ccc(OCCCC(=O)N/N=C/c2ccc(Cl)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C19H19BrCl2N2O2/c1-2-13-6-8-18(15(20)10-13)26-9-3-4-19(25)24-23-12-14-5-7-16(21)17(22)11-14/h5-8,10-12H,2-4,9H2,1H3,(H,24,25)/b23-12+ |
| InChIKey | ZTUIIVJOOPJKAB-FSJBWODESA-N |
| XLogP | 5.63 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.18 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|