C28H28BrN3O2 — CID 19208268
N-[(E)-(1-benzylindol-3-yl)methylideneamino]-4-(2-bromo-4-ethylphenoxy)butanamide (PubChem CID 19208268) has the molecular formula C28H28BrN3O2 and a molecular weight of 518.46 g/mol. Its IUPAC name is N-[(E)-(1-benzylindol-3-yl)methylideneamino]-4-(2-bromo-4-ethylphenoxy)butanamide.
| Compound Name | N-[(E)-(1-benzylindol-3-yl)methylideneamino]-4-(2-bromo-4-ethylphenoxy)butanamide |
|---|---|
| PubChem CID | 19208268 |
| Molecular Formula | C28H28BrN3O2 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | N-[(E)-(1-benzylindol-3-yl)methylideneamino]-4-(2-bromo-4-ethylphenoxy)butanamide |
| SMILES | CCc1ccc(OCCCC(=O)N/N=C/c2cn(Cc3ccccc3)c3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C28H28BrN3O2/c1-2-21-14-15-27(25(29)17-21)34-16-8-13-28(33)31-30-18-23-20-32(19-22-9-4-3-5-10-22)26-12-7-6-11-24(23)26/h3-7,9-12,14-15,17-18,20H,2,8,13,16,19H2,1H3,(H,31,33)/b30-18+ |
| InChIKey | DVRQZDJGDQYNIH-UXHLAJHPSA-N |
| XLogP | 6.32 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|