C18H20BrN3O2 — CID 19208240
4-(2-bromo-4-ethylphenoxy)-N-[(E)-pyridin-3-ylmethylideneamino]butanamide (PubChem CID 19208240) has the molecular formula C18H20BrN3O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is 4-(2-bromo-4-ethylphenoxy)-N-[(E)-pyridin-3-ylmethylideneamino]butanamide.
| Compound Name | 4-(2-bromo-4-ethylphenoxy)-N-[(E)-pyridin-3-ylmethylideneamino]butanamide |
|---|---|
| PubChem CID | 19208240 |
| Molecular Formula | C18H20BrN3O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 4-(2-bromo-4-ethylphenoxy)-N-[(E)-pyridin-3-ylmethylideneamino]butanamide |
| SMILES | CCc1ccc(OCCCC(=O)N/N=C/c2cccnc2)c(Br)c1 |
| InChI | InChI=1S/C18H20BrN3O2/c1-2-14-7-8-17(16(19)11-14)24-10-4-6-18(23)22-21-13-15-5-3-9-20-12-15/h3,5,7-9,11-13H,2,4,6,10H2,1H3,(H,22,23)/b21-13+ |
| InChIKey | IVNGPILCLDRCNH-FYJGNVAPSA-N |
| XLogP | 3.72 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|