C27H24ClN3O3S2 — CID 17274752
N-tert-butyl-3-chloro-7-[[(E)-3-(5-phenylfuran-2-yl)prop-2-enoyl]carbamothioylamino]-1-benzothiophene-2-carboxamide (PubChem CID 17274752) has the molecular formula C27H24ClN3O3S2 and a molecular weight of 538.09 g/mol. Its IUPAC name is N-tert-butyl-3-chloro-7-[[(E)-3-(5-phenylfuran-2-yl)prop-2-enoyl]carbamothioylamino]-1-benzothiophene-2-carboxamide.
| Compound Name | N-tert-butyl-3-chloro-7-[[(E)-3-(5-phenylfuran-2-yl)prop-2-enoyl]carbamothioylamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17274752 |
| Molecular Formula | C27H24ClN3O3S2 |
| Molecular Weight | 538.09 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | N-tert-butyl-3-chloro-7-[[(E)-3-(5-phenylfuran-2-yl)prop-2-enoyl]carbamothioylamino]-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1sc2c(NC(=S)NC(=O)/C=C/c3ccc(-c4ccccc4)o3)cccc2c1Cl |
| InChI | InChI=1S/C27H24ClN3O3S2/c1-27(2,3)31-25(33)24-22(28)18-10-7-11-19(23(18)36-24)29-26(35)30-21(32)15-13-17-12-14-20(34-17)16-8-5-4-6-9-16/h4-15H,1-3H3,(H,31,33)(H2,29,30,32,35)/b15-13+ |
| InChIKey | CHUUKRVCPIWUTI-FYWRMAATSA-N |
| XLogP | 6.87 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.09 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|