C24H26ClN3O2S2 — CID 17098591
N-tert-butyl-3-chloro-7-[(4-propan-2-ylbenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide (PubChem CID 17098591) has the molecular formula C24H26ClN3O2S2 and a molecular weight of 488.08 g/mol. Its IUPAC name is N-tert-butyl-3-chloro-7-[(4-propan-2-ylbenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide.
| Compound Name | N-tert-butyl-3-chloro-7-[(4-propan-2-ylbenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17098591 |
| Molecular Formula | C24H26ClN3O2S2 |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-tert-butyl-3-chloro-7-[(4-propan-2-ylbenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)c1ccc(C(=O)NC(=S)Nc2cccc3c(Cl)c(C(=O)NC(C)(C)C)sc23)cc1 |
| InChI | InChI=1S/C24H26ClN3O2S2/c1-13(2)14-9-11-15(12-10-14)21(29)27-23(31)26-17-8-6-7-16-18(25)20(32-19(16)17)22(30)28-24(3,4)5/h6-13H,1-5H3,(H,28,30)(H2,26,27,29,31) |
| InChIKey | AMIYNIYBOUFNBA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|