C26H23BrClN3O3S2 — CID 17274177
7-[(4-bromo-3-methoxynaphthalene-2-carbonyl)carbamothioylamino]-N-tert-butyl-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 17274177) has the molecular formula C26H23BrClN3O3S2 and a molecular weight of 604.98 g/mol. Its IUPAC name is 7-[(4-bromo-3-methoxynaphthalene-2-carbonyl)carbamothioylamino]-N-tert-butyl-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | 7-[(4-bromo-3-methoxynaphthalene-2-carbonyl)carbamothioylamino]-N-tert-butyl-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17274177 |
| Molecular Formula | C26H23BrClN3O3S2 |
| Molecular Weight | 604.98 g/mol |
| Exact Mass | 603.01 |
| IUPAC Name | 7-[(4-bromo-3-methoxynaphthalene-2-carbonyl)carbamothioylamino]-N-tert-butyl-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | COc1c(C(=O)NC(=S)Nc2cccc3c(Cl)c(C(=O)NC(C)(C)C)sc23)cc2ccccc2c1Br |
| InChI | InChI=1S/C26H23BrClN3O3S2/c1-26(2,3)31-24(33)22-19(28)15-10-7-11-17(21(15)36-22)29-25(35)30-23(32)16-12-13-8-5-6-9-14(13)18(27)20(16)34-4/h5-12H,1-4H3,(H,31,33)(H2,29,30,32,35) |
| InChIKey | ZCZDAPKRLLZLHR-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.98 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|