C25H28ClN3O3S2 — CID 17274185
7-[(3-butoxybenzoyl)carbamothioylamino]-N-tert-butyl-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 17274185) has the molecular formula C25H28ClN3O3S2 and a molecular weight of 518.10 g/mol. Its IUPAC name is 7-[(3-butoxybenzoyl)carbamothioylamino]-N-tert-butyl-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | 7-[(3-butoxybenzoyl)carbamothioylamino]-N-tert-butyl-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17274185 |
| Molecular Formula | C25H28ClN3O3S2 |
| Molecular Weight | 518.10 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | 7-[(3-butoxybenzoyl)carbamothioylamino]-N-tert-butyl-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)Nc2cccc3c(Cl)c(C(=O)NC(C)(C)C)sc23)c1 |
| InChI | InChI=1S/C25H28ClN3O3S2/c1-5-6-13-32-16-10-7-9-15(14-16)22(30)28-24(33)27-18-12-8-11-17-19(26)21(34-20(17)18)23(31)29-25(2,3)4/h7-12,14H,5-6,13H2,1-4H3,(H,29,31)(H2,27,28,30,33) |
| InChIKey | FTZPBRIGBXOPNT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.10 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|