C24H26ClN3O3S2 — CID 17098540
N-tert-butyl-3-chloro-7-[(3-propan-2-yloxybenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide (PubChem CID 17098540) has the molecular formula C24H26ClN3O3S2 and a molecular weight of 504.08 g/mol. Its IUPAC name is N-tert-butyl-3-chloro-7-[(3-propan-2-yloxybenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide.
| Compound Name | N-tert-butyl-3-chloro-7-[(3-propan-2-yloxybenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17098540 |
| Molecular Formula | C24H26ClN3O3S2 |
| Molecular Weight | 504.08 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | N-tert-butyl-3-chloro-7-[(3-propan-2-yloxybenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c(Cl)c(C(=O)NC(C)(C)C)sc23)c1 |
| InChI | InChI=1S/C24H26ClN3O3S2/c1-13(2)31-15-9-6-8-14(12-15)21(29)27-23(32)26-17-11-7-10-16-18(25)20(33-19(16)17)22(30)28-24(3,4)5/h6-13H,1-5H3,(H,28,30)(H2,26,27,29,32) |
| InChIKey | IOZWHWFUIZBYNQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.08 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|