C21H19ClFN3O2S2 — CID 17098690
N-tert-butyl-3-chloro-7-[(4-fluorobenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide (PubChem CID 17098690) has the molecular formula C21H19ClFN3O2S2 and a molecular weight of 463.99 g/mol. Its IUPAC name is N-tert-butyl-3-chloro-7-[(4-fluorobenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide.
| Compound Name | N-tert-butyl-3-chloro-7-[(4-fluorobenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17098690 |
| Molecular Formula | C21H19ClFN3O2S2 |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | N-tert-butyl-3-chloro-7-[(4-fluorobenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1sc2c(NC(=S)NC(=O)c3ccc(F)cc3)cccc2c1Cl |
| InChI | InChI=1S/C21H19ClFN3O2S2/c1-21(2,3)26-19(28)17-15(22)13-5-4-6-14(16(13)30-17)24-20(29)25-18(27)11-7-9-12(23)10-8-11/h4-10H,1-3H3,(H,26,28)(H2,24,25,27,29) |
| InChIKey | JCYCMJYBVIHKGU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|