C22H21Cl2N3O2S2 — CID 17274281
N-tert-butyl-3-chloro-7-[(2-chloro-4-methylbenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide (PubChem CID 17274281) has the molecular formula C22H21Cl2N3O2S2 and a molecular weight of 494.47 g/mol. Its IUPAC name is N-tert-butyl-3-chloro-7-[(2-chloro-4-methylbenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide.
| Compound Name | N-tert-butyl-3-chloro-7-[(2-chloro-4-methylbenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17274281 |
| Molecular Formula | C22H21Cl2N3O2S2 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | N-tert-butyl-3-chloro-7-[(2-chloro-4-methylbenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cccc3c(Cl)c(C(=O)NC(C)(C)C)sc23)c(Cl)c1 |
| InChI | InChI=1S/C22H21Cl2N3O2S2/c1-11-8-9-12(14(23)10-11)19(28)26-21(30)25-15-7-5-6-13-16(24)18(31-17(13)15)20(29)27-22(2,3)4/h5-10H,1-4H3,(H,27,29)(H2,25,26,28,30) |
| InChIKey | AEZSMKBGLZKHSM-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|