C18H17ClN2O2S2 — CID 17274787
N-tert-butyl-3-chloro-7-(thiophene-2-carbonylamino)-1-benzothiophene-2-carboxamide (PubChem CID 17274787) has the molecular formula C18H17ClN2O2S2 and a molecular weight of 392.93 g/mol. Its IUPAC name is N-tert-butyl-3-chloro-7-(thiophene-2-carbonylamino)-1-benzothiophene-2-carboxamide.
| Compound Name | N-tert-butyl-3-chloro-7-(thiophene-2-carbonylamino)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17274787 |
| Molecular Formula | C18H17ClN2O2S2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | N-tert-butyl-3-chloro-7-(thiophene-2-carbonylamino)-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1sc2c(NC(=O)c3cccs3)cccc2c1Cl |
| InChI | InChI=1S/C18H17ClN2O2S2/c1-18(2,3)21-17(23)15-13(19)10-6-4-7-11(14(10)25-15)20-16(22)12-8-5-9-24-12/h4-9H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | WQXXHGPJFRGECB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |