C22H18ClF4N3O3S2 — CID 17336257
N-tert-butyl-3-chloro-7-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide (PubChem CID 17336257) has the molecular formula C22H18ClF4N3O3S2 and a molecular weight of 547.98 g/mol. Its IUPAC name is N-tert-butyl-3-chloro-7-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide.
| Compound Name | N-tert-butyl-3-chloro-7-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17336257 |
| Molecular Formula | C22H18ClF4N3O3S2 |
| Molecular Weight | 547.98 g/mol |
| Exact Mass | 547.04 |
| IUPAC Name | N-tert-butyl-3-chloro-7-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)carbamothioylamino]-1-benzothiophene-2-carboxamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2cccc3c(Cl)c(C(=O)NC(C)(C)C)sc23)c(F)c1F |
| InChI | InChI=1S/C22H18ClF4N3O3S2/c1-22(2,3)30-20(32)18-11(23)8-6-5-7-9(17(8)35-18)28-21(34)29-19(31)10-12(24)14(26)16(33-4)15(27)13(10)25/h5-7H,1-4H3,(H,30,32)(H2,28,29,31,34) |
| InChIKey | DZPSWVYKXRVGFN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.98 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|