C26H22N2O4S — CID 28687434
N-[[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]carbamothioyl]-4-phenylbenzamide (PubChem CID 28687434) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-[[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]carbamothioyl]-4-phenylbenzamide.
| Compound Name | N-[[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]carbamothioyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 28687434 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[[3-[5-(hydroxymethyl)furan-2-yl]-4-methoxyphenyl]carbamothioyl]-4-phenylbenzamide |
| SMILES | COc1ccc(NC(=S)NC(=O)c2ccc(-c3ccccc3)cc2)cc1-c1ccc(CO)o1 |
| InChI | InChI=1S/C26H22N2O4S/c1-31-23-13-11-20(15-22(23)24-14-12-21(16-29)32-24)27-26(33)28-25(30)19-9-7-18(8-10-19)17-5-3-2-4-6-17/h2-15,29H,16H2,1H3,(H2,27,28,30,33) |
| InChIKey | FPZFAATXKZIMPC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|