C19H14Br2INO4 — CID 43866247
3,5-dibromo-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-2-iodobenzamide (PubChem CID 43866247) has the molecular formula C19H14Br2INO4 and a molecular weight of 607.04 g/mol. Its IUPAC name is 3,5-dibromo-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-2-iodobenzamide.
| Compound Name | 3,5-dibromo-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 43866247 |
| Molecular Formula | C19H14Br2INO4 |
| Molecular Weight | 607.04 g/mol |
| Exact Mass | 604.83 |
| IUPAC Name | 3,5-dibromo-N-[5-[5-(hydroxymethyl)furan-2-yl]-2-methoxyphenyl]-2-iodobenzamide |
| SMILES | COc1ccc(-c2ccc(CO)o2)cc1NC(=O)c1cc(Br)cc(Br)c1I |
| InChI | InChI=1S/C19H14Br2INO4/c1-26-17-4-2-10(16-5-3-12(9-24)27-16)6-15(17)23-19(25)13-7-11(20)8-14(21)18(13)22/h2-8,24H,9H2,1H3,(H,23,25) |
| InChIKey | RQUNAXDCORCRSZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.04 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|