C16H12Cl2N2O4S — CID 1328927
3-[(3,4-dichlorobenzoyl)carbamothioylamino]-4-methoxybenzoic acid (PubChem CID 1328927) has the molecular formula C16H12Cl2N2O4S and a molecular weight of 399.26 g/mol. Its IUPAC name is 3-[(3,4-dichlorobenzoyl)carbamothioylamino]-4-methoxybenzoic acid.
| Compound Name | 3-[(3,4-dichlorobenzoyl)carbamothioylamino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 1328927 |
| Molecular Formula | C16H12Cl2N2O4S |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 3-[(3,4-dichlorobenzoyl)carbamothioylamino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NC(=S)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2O4S/c1-24-13-5-3-9(15(22)23)7-12(13)19-16(25)20-14(21)8-2-4-10(17)11(18)6-8/h2-7H,1H3,(H,22,23)(H2,19,20,21,25) |
| InChIKey | IZTAVJOIEZSDRN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|