C27H28BrN3O4 — CID 17350309
N-[4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamoyl]phenyl]-3-methylbenzamide (PubChem CID 17350309) has the molecular formula C27H28BrN3O4 and a molecular weight of 538.44 g/mol. Its IUPAC name is N-[4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamoyl]phenyl]-3-methylbenzamide.
| Compound Name | N-[4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamoyl]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 17350309 |
| Molecular Formula | C27H28BrN3O4 |
| Molecular Weight | 538.44 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | N-[4-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamoyl]phenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(C(=O)NNC(=O)COc3ccc(C(C)(C)C)cc3Br)cc2)c1 |
| InChI | InChI=1S/C27H28BrN3O4/c1-17-6-5-7-19(14-17)25(33)29-21-11-8-18(9-12-21)26(34)31-30-24(32)16-35-23-13-10-20(15-22(23)28)27(2,3)4/h5-15H,16H2,1-4H3,(H,29,33)(H,30,32)(H,31,34) |
| InChIKey | LLJCZXTXRJAZBZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|