C16H18N2O3S — CID 17175603
methyl 3-[bis(prop-2-enyl)carbamothioylcarbamoyl]benzoate (PubChem CID 17175603) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is methyl 3-[bis(prop-2-enyl)carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 3-[bis(prop-2-enyl)carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17175603 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | methyl 3-[bis(prop-2-enyl)carbamothioylcarbamoyl]benzoate |
| SMILES | C=CCN(CC=C)C(=S)NC(=O)c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C16H18N2O3S/c1-4-9-18(10-5-2)16(22)17-14(19)12-7-6-8-13(11-12)15(20)21-3/h4-8,11H,1-2,9-10H2,3H3,(H,17,19,22) |
| InChIKey | CMIAGCBTUGXOLA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|