C15H19ClN2OS — CID 4940486
3-chloro-N-[cyclohexyl(methyl)carbamothioyl]benzamide (PubChem CID 4940486) has the molecular formula C15H19ClN2OS and a molecular weight of 310.85 g/mol. Its IUPAC name is 3-chloro-N-[cyclohexyl(methyl)carbamothioyl]benzamide.
| Compound Name | 3-chloro-N-[cyclohexyl(methyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4940486 |
| Molecular Formula | C15H19ClN2OS |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 3-chloro-N-[cyclohexyl(methyl)carbamothioyl]benzamide |
| SMILES | CN(C(=S)NC(=O)c1cccc(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C15H19ClN2OS/c1-18(13-8-3-2-4-9-13)15(20)17-14(19)11-6-5-7-12(16)10-11/h5-7,10,13H,2-4,8-9H2,1H3,(H,17,19,20) |
| InChIKey | NVBILLHEZURGQV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|