C26H33N3O3S — CID 4957122
2-[(3-butoxybenzoyl)carbamothioylamino]-N-cyclohexyl-N-methylbenzamide (PubChem CID 4957122) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is 2-[(3-butoxybenzoyl)carbamothioylamino]-N-cyclohexyl-N-methylbenzamide.
| Compound Name | 2-[(3-butoxybenzoyl)carbamothioylamino]-N-cyclohexyl-N-methylbenzamide |
|---|---|
| PubChem CID | 4957122 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-[(3-butoxybenzoyl)carbamothioylamino]-N-cyclohexyl-N-methylbenzamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)Nc2ccccc2C(=O)N(C)C2CCCCC2)c1 |
| InChI | InChI=1S/C26H33N3O3S/c1-3-4-17-32-21-14-10-11-19(18-21)24(30)28-26(33)27-23-16-9-8-15-22(23)25(31)29(2)20-12-6-5-7-13-20/h8-11,14-16,18,20H,3-7,12-13,17H2,1-2H3,(H2,27,28,30,33) |
| InChIKey | GXADOMLUDUUFOG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|