C24H26FN3O2S — CID 4939099
N-cyclohexyl-2-[3-(4-fluorophenyl)prop-2-enoylcarbamothioylamino]-N-methylbenzamide (PubChem CID 4939099) has the molecular formula C24H26FN3O2S and a molecular weight of 439.56 g/mol. Its IUPAC name is N-cyclohexyl-2-[3-(4-fluorophenyl)prop-2-enoylcarbamothioylamino]-N-methylbenzamide.
| Compound Name | N-cyclohexyl-2-[3-(4-fluorophenyl)prop-2-enoylcarbamothioylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 4939099 |
| Molecular Formula | C24H26FN3O2S |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-cyclohexyl-2-[3-(4-fluorophenyl)prop-2-enoylcarbamothioylamino]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccccc1NC(=S)NC(=O)C=Cc1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C24H26FN3O2S/c1-28(19-7-3-2-4-8-19)23(30)20-9-5-6-10-21(20)26-24(31)27-22(29)16-13-17-11-14-18(25)15-12-17/h5-6,9-16,19H,2-4,7-8H2,1H3,(H2,26,27,29,31) |
| InChIKey | BVNKBUGZDAQKDI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|