C21H23N3O5S — CID 17178653
methyl 4-[[2-(3-methoxypropylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate (PubChem CID 17178653) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is methyl 4-[[2-(3-methoxypropylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 4-[[2-(3-methoxypropylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17178653 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | methyl 4-[[2-(3-methoxypropylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate |
| SMILES | COCCCNC(=O)c1ccccc1NC(=S)NC(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C21H23N3O5S/c1-28-13-5-12-22-19(26)16-6-3-4-7-17(16)23-21(30)24-18(25)14-8-10-15(11-9-14)20(27)29-2/h3-4,6-11H,5,12-13H2,1-2H3,(H,22,26)(H2,23,24,25,30) |
| InChIKey | UHMFFXDIIADVMU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|