C21H23N3O4S — CID 17178571
methyl 4-[[2-(tert-butylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate (PubChem CID 17178571) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is methyl 4-[[2-(tert-butylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 4-[[2-(tert-butylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17178571 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | methyl 4-[[2-(tert-butylcarbamoyl)phenyl]carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H23N3O4S/c1-21(2,3)24-18(26)15-7-5-6-8-16(15)22-20(29)23-17(25)13-9-11-14(12-10-13)19(27)28-4/h5-12H,1-4H3,(H,24,26)(H2,22,23,25,29) |
| InChIKey | STLJCVFLHHTBDQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|