C19H19Cl2N3O3S — CID 17148411
2,4-dichloro-N-[[2-(3-methoxypropylcarbamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 17148411) has the molecular formula C19H19Cl2N3O3S and a molecular weight of 440.35 g/mol. Its IUPAC name is 2,4-dichloro-N-[[2-(3-methoxypropylcarbamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[2-(3-methoxypropylcarbamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17148411 |
| Molecular Formula | C19H19Cl2N3O3S |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 2,4-dichloro-N-[[2-(3-methoxypropylcarbamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | COCCCNC(=O)c1ccccc1NC(=S)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2N3O3S/c1-27-10-4-9-22-17(25)14-5-2-3-6-16(14)23-19(28)24-18(26)13-8-7-12(20)11-15(13)21/h2-3,5-8,11H,4,9-10H2,1H3,(H,22,25)(H2,23,24,26,28) |
| InChIKey | POPWGFUAVRWQGD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|