C22H26N2O5 — CID 55587996
N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 55587996) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55587996 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | CCNC(=O)COc1ccc(NC(=O)c2ccc(OCC3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-2-23-21(25)15-29-19-11-7-17(8-12-19)24-22(26)16-5-9-18(10-6-16)28-14-20-4-3-13-27-20/h5-12,20H,2-4,13-15H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | MFASGMUZSPLUEU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |