C15H15F3N2OS — CID 86908674
N-(1-thiophen-2-ylethyl)-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 86908674) has the molecular formula C15H15F3N2OS and a molecular weight of 328.36 g/mol. Its IUPAC name is N-(1-thiophen-2-ylethyl)-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-(1-thiophen-2-ylethyl)-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 86908674 |
| Molecular Formula | C15H15F3N2OS |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-(1-thiophen-2-ylethyl)-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | CC(NC(=O)CNc1cccc(C(F)(F)F)c1)c1cccs1 |
| InChI | InChI=1S/C15H15F3N2OS/c1-10(13-6-3-7-22-13)20-14(21)9-19-12-5-2-4-11(8-12)15(16,17)18/h2-8,10,19H,9H2,1H3,(H,20,21) |
| InChIKey | NRONLPBGHXBDRK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |