C16H19N3O3S — CID 119701086
N-[3-[[2-(2-methoxyethylamino)acetyl]amino]phenyl]thiophene-2-carboxamide (PubChem CID 119701086) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-[3-[[2-(2-methoxyethylamino)acetyl]amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[2-(2-methoxyethylamino)acetyl]amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119701086 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[3-[[2-(2-methoxyethylamino)acetyl]amino]phenyl]thiophene-2-carboxamide |
| SMILES | COCCNCC(=O)Nc1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C16H19N3O3S/c1-22-8-7-17-11-15(20)18-12-4-2-5-13(10-12)19-16(21)14-6-3-9-23-14/h2-6,9-10,17H,7-8,11H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | HSPDYDOWKZAQBE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|