C17H13N5OS — CID 113051329
N-[6-(4-cyanoanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide (PubChem CID 113051329) has the molecular formula C17H13N5OS and a molecular weight of 335.39 g/mol. Its IUPAC name is N-[6-(4-cyanoanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[6-(4-cyanoanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113051329 |
| Molecular Formula | C17H13N5OS |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-[6-(4-cyanoanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide |
| SMILES | N#Cc1ccc(Nc2ccc(NC(=O)Cc3cccs3)nn2)cc1 |
| InChI | InChI=1S/C17H13N5OS/c18-11-12-3-5-13(6-4-12)19-15-7-8-16(22-21-15)20-17(23)10-14-2-1-9-24-14/h1-9H,10H2,(H,19,21)(H,20,22,23) |
| InChIKey | FSVQPZIXHZCVNZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |