C10H8N4OS — CID 79503473
N-(4-cyano-1H-pyrazol-5-yl)-2-thiophen-2-ylacetamide (PubChem CID 79503473) has the molecular formula C10H8N4OS and a molecular weight of 232.27 g/mol. Its IUPAC name is N-(4-cyano-1H-pyrazol-5-yl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(4-cyano-1H-pyrazol-5-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 79503473 |
| Molecular Formula | C10H8N4OS |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | N-(4-cyano-1H-pyrazol-5-yl)-2-thiophen-2-ylacetamide |
| SMILES | N#Cc1cn[nH]c1NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C10H8N4OS/c11-5-7-6-12-14-10(7)13-9(15)4-8-2-1-3-16-8/h1-3,6H,4H2,(H2,12,13,14,15) |
| InChIKey | PQDLIQUILYBNHI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |