C15H16N4O — CID 113038209
2-phenyl-N-[6-(prop-2-enylamino)pyridazin-3-yl]acetamide (PubChem CID 113038209) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-phenyl-N-[6-(prop-2-enylamino)pyridazin-3-yl]acetamide.
| Compound Name | 2-phenyl-N-[6-(prop-2-enylamino)pyridazin-3-yl]acetamide |
|---|---|
| PubChem CID | 113038209 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-phenyl-N-[6-(prop-2-enylamino)pyridazin-3-yl]acetamide |
| SMILES | C=CCNc1ccc(NC(=O)Cc2ccccc2)nn1 |
| InChI | InChI=1S/C15H16N4O/c1-2-10-16-13-8-9-14(19-18-13)17-15(20)11-12-6-4-3-5-7-12/h2-9H,1,10-11H2,(H,16,18)(H,17,19,20) |
| InChIKey | OGBBEIYOMGEPGR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|