C10H14N2O2S — CID 110475965
2-methyl-2-[(2-thiophen-2-ylacetyl)amino]propanamide (PubChem CID 110475965) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-methyl-2-[(2-thiophen-2-ylacetyl)amino]propanamide.
| Compound Name | 2-methyl-2-[(2-thiophen-2-ylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 110475965 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-methyl-2-[(2-thiophen-2-ylacetyl)amino]propanamide |
| SMILES | CC(C)(NC(=O)Cc1cccs1)C(N)=O |
| InChI | InChI=1S/C10H14N2O2S/c1-10(2,9(11)14)12-8(13)6-7-4-3-5-15-7/h3-5H,6H2,1-2H3,(H2,11,14)(H,12,13) |
| InChIKey | QZWTWEGJSFZESG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |