C18H18FN3O3S — CID 17034994
4-(2,5-dioxopyrrolidin-1-yl)-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]butanamide (PubChem CID 17034994) has the molecular formula C18H18FN3O3S and a molecular weight of 375.43 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 17034994 |
| Molecular Formula | C18H18FN3O3S |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]butanamide |
| SMILES | O=C(CCCN1C(=O)CCC1=O)Nc1ncc(Cc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C18H18FN3O3S/c19-13-5-3-12(4-6-13)10-14-11-20-18(26-14)21-15(23)2-1-9-22-16(24)7-8-17(22)25/h3-6,11H,1-2,7-10H2,(H,20,21,23) |
| InChIKey | GFQPTCBGUHZTJQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|