C21H14F3N3O2S4 — CID 6204135
2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 6204135) has the molecular formula C21H14F3N3O2S4 and a molecular weight of 525.62 g/mol. Its IUPAC name is 2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 6204135 |
| Molecular Formula | C21H14F3N3O2S4 |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 524.99 |
| IUPAC Name | 2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CN1C(=O)/C(=C\c2cccs2)SC1=S)Nc1ncc(Cc2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C21H14F3N3O2S4/c22-21(23,24)13-4-1-3-12(7-13)8-15-10-25-19(32-15)26-17(28)11-27-18(29)16(33-20(27)30)9-14-5-2-6-31-14/h1-7,9-10H,8,11H2,(H,25,26,28)/b16-9+ |
| InChIKey | ZJBQNMFQWJBOQW-CXUHLZMHSA-N |
| XLogP | 5.65 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|