C22H16ClN3O3S2 — CID 18874073
2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 18874073) has the molecular formula C22H16ClN3O3S2 and a molecular weight of 469.98 g/mol. Its IUPAC name is 2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 18874073 |
| Molecular Formula | C22H16ClN3O3S2 |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccccc2)C1=O)Nc1ncc(Cc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C22H16ClN3O3S2/c23-16-8-4-7-15(9-16)10-17-12-24-21(30-17)25-19(27)13-26-20(28)18(31-22(26)29)11-14-5-2-1-3-6-14/h1-9,11-12H,10,13H2,(H,24,25,27)/b18-11- |
| InChIKey | LEEFOTGKQSZXMZ-WQRHYEAKSA-N |
| XLogP | 5.06 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|