C23H17Cl2N3O3S2 — CID 162395743
2-[(5Z)-5-[(2,5-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 162395743) has the molecular formula C23H17Cl2N3O3S2 and a molecular weight of 518.45 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2,5-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(5Z)-5-[(2,5-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 162395743 |
| Molecular Formula | C23H17Cl2N3O3S2 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | 2-[(5Z)-5-[(2,5-dichlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[5-[(4-methylphenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1ccc(Cc2cnc(NC(=O)CN3C(=O)S/C(=C\c4cc(Cl)ccc4Cl)C3=O)s2)cc1 |
| InChI | InChI=1S/C23H17Cl2N3O3S2/c1-13-2-4-14(5-3-13)8-17-11-26-22(32-17)27-20(29)12-28-21(30)19(33-23(28)31)10-15-9-16(24)6-7-18(15)25/h2-7,9-11H,8,12H2,1H3,(H,26,27,29)/b19-10- |
| InChIKey | PNHHCZGFOGKEQD-GRSHGNNSSA-N |
| XLogP | 6.02 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|