C22H14Cl3N3O3S2 — CID 18808515
2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 18808515) has the molecular formula C22H14Cl3N3O3S2 and a molecular weight of 538.87 g/mol. Its IUPAC name is 2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 18808515 |
| Molecular Formula | C22H14Cl3N3O3S2 |
| Molecular Weight | 538.87 g/mol |
| Exact Mass | 536.95 |
| IUPAC Name | 2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(Cl)cc2)C1=O)Nc1ncc(Cc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C22H14Cl3N3O3S2/c23-14-4-1-12(2-5-14)9-18-20(30)28(22(31)33-18)11-19(29)27-21-26-10-15(32-21)7-13-3-6-16(24)17(25)8-13/h1-6,8-10H,7,11H2,(H,26,27,29)/b18-9- |
| InChIKey | SBJNKXKOHRCFPL-NVMNQCDNSA-N |
| XLogP | 6.37 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.87 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|