C18H16ClN3O3S2 — CID 18808957
N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-(2,4-dioxo-5-propan-2-ylidene-1,3-thiazolidin-3-yl)acetamide (PubChem CID 18808957) has the molecular formula C18H16ClN3O3S2 and a molecular weight of 421.93 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-(2,4-dioxo-5-propan-2-ylidene-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-(2,4-dioxo-5-propan-2-ylidene-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 18808957 |
| Molecular Formula | C18H16ClN3O3S2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-(2,4-dioxo-5-propan-2-ylidene-1,3-thiazolidin-3-yl)acetamide |
| SMILES | CC(C)=C1SC(=O)N(CC(=O)Nc2ncc(Cc3ccc(Cl)cc3)s2)C1=O |
| InChI | InChI=1S/C18H16ClN3O3S2/c1-10(2)15-16(24)22(18(25)27-15)9-14(23)21-17-20-8-13(26-17)7-11-3-5-12(19)6-4-11/h3-6,8H,7,9H2,1-2H3,(H,20,21,23) |
| InChIKey | TWIGASZRYKVGFJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|