C26H17Cl2N3O3S3 — CID 18808035
N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[(5Z)-4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide (PubChem CID 18808035) has the molecular formula C26H17Cl2N3O3S3 and a molecular weight of 586.55 g/mol. Its IUPAC name is N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[(5Z)-4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[(5Z)-4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 18808035 |
| Molecular Formula | C26H17Cl2N3O3S3 |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 584.98 |
| IUPAC Name | N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[(5Z)-4-oxo-5-[(5-phenylfuran-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2ccc(-c3ccccc3)o2)SC1=S)Nc1ncc(Cc2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C26H17Cl2N3O3S3/c27-17-6-8-20(28)16(10-17)11-19-13-29-25(36-19)30-23(32)14-31-24(33)22(37-26(31)35)12-18-7-9-21(34-18)15-4-2-1-3-5-15/h1-10,12-13H,11,14H2,(H,29,30,32)/b22-12- |
| InChIKey | VCKHHJHIVXEJMH-UUYOSTAYSA-N |
| XLogP | 7.14 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|