C28H19Cl2N3O3S3 — CID 18808028
N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[4-[(Z)-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 18808028) has the molecular formula C28H19Cl2N3O3S3 and a molecular weight of 612.59 g/mol. Its IUPAC name is N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[4-[(Z)-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[4-[(Z)-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 18808028 |
| Molecular Formula | C28H19Cl2N3O3S3 |
| Molecular Weight | 612.59 g/mol |
| Exact Mass | 611.00 |
| IUPAC Name | N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[4-[(Z)-(4-oxo-3-phenyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc(/C=C2\SC(=S)N(c3ccccc3)C2=O)cc1)Nc1ncc(Cc2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C28H19Cl2N3O3S3/c29-19-8-11-23(30)18(13-19)14-22-15-31-27(38-22)32-25(34)16-36-21-9-6-17(7-10-21)12-24-26(35)33(28(37)39-24)20-4-2-1-3-5-20/h1-13,15H,14,16H2,(H,31,32,34)/b24-12- |
| InChIKey | SHYCRCLEWKZSJE-MSXFZWOLSA-N |
| XLogP | 7.46 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.59 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|