C22H15Cl2N3O2S3 — CID 162395752
N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzamide (PubChem CID 162395752) has the molecular formula C22H15Cl2N3O2S3 and a molecular weight of 520.49 g/mol. Its IUPAC name is N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzamide.
| Compound Name | N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 162395752 |
| Molecular Formula | C22H15Cl2N3O2S3 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 518.97 |
| IUPAC Name | N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-4-[(Z)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzamide |
| SMILES | CN1C(=O)/C(=C/c2ccc(C(=O)Nc3ncc(Cc4cc(Cl)ccc4Cl)s3)cc2)SC1=S |
| InChI | InChI=1S/C22H15Cl2N3O2S3/c1-27-20(29)18(32-22(27)30)8-12-2-4-13(5-3-12)19(28)26-21-25-11-16(31-21)10-14-9-15(23)6-7-17(14)24/h2-9,11H,10H2,1H3,(H,25,26,28)/b18-8- |
| InChIKey | RREQACLKAWDQNW-LSCVHKIXSA-N |
| XLogP | 6.12 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|